C16H19F2N3O3 — CID 170720985
3-[(5-ethoxy-2,2-difluorocyclohexyl)methylamino]-4-nitrobenzonitrile (PubChem CID 170720985) has the molecular formula C16H19F2N3O3 and a molecular weight of 339.34 g/mol. Its IUPAC name is 3-[(5-ethoxy-2,2-difluorocyclohexyl)methylamino]-4-nitrobenzonitrile.
| Compound Name | 3-[(5-ethoxy-2,2-difluorocyclohexyl)methylamino]-4-nitrobenzonitrile |
|---|---|
| PubChem CID | 170720985 |
| Molecular Formula | C16H19F2N3O3 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 3-[(5-ethoxy-2,2-difluorocyclohexyl)methylamino]-4-nitrobenzonitrile |
| SMILES | CCOC1CCC(F)(F)C(CNc2cc(C#N)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H19F2N3O3/c1-2-24-13-5-6-16(17,18)12(8-13)10-20-14-7-11(9-19)3-4-15(14)21(22)23/h3-4,7,12-13,20H,2,5-6,8,10H2,1H3 |
| InChIKey | SNZQYAIUDJAVHM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|