C12H19N — CID 170721218
1-cyclopropyl-N-[(E)-2,3-dimethylbut-1-enyl]prop-2-en-1-imine (PubChem CID 170721218) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 1-cyclopropyl-N-[(E)-2,3-dimethylbut-1-enyl]prop-2-en-1-imine.
| Compound Name | 1-cyclopropyl-N-[(E)-2,3-dimethylbut-1-enyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 170721218 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 1-cyclopropyl-N-[(E)-2,3-dimethylbut-1-enyl]prop-2-en-1-imine |
| SMILES | C=C/C(=N\C=C(/C)C(C)C)C1CC1 |
| InChI | InChI=1S/C12H19N/c1-5-12(11-6-7-11)13-8-10(4)9(2)3/h5,8-9,11H,1,6-7H2,2-4H3/b10-8+,13-12+ |
| InChIKey | OQKSDMKLQIWXLT-QZWQQMBISA-N |
| XLogP | 3.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|