C23H22F3N5O2 — CID 170722062
3-(8-methyl-4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-[2-[3-(trifluoromethyl)anilino]ethyl]propanamide (PubChem CID 170722062) has the molecular formula C23H22F3N5O2 and a molecular weight of 457.46 g/mol. Its IUPAC name is 3-(8-methyl-4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-[2-[3-(trifluoromethyl)anilino]ethyl]propanamide.
| Compound Name | 3-(8-methyl-4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-[2-[3-(trifluoromethyl)anilino]ethyl]propanamide |
|---|---|
| PubChem CID | 170722062 |
| Molecular Formula | C23H22F3N5O2 |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 3-(8-methyl-4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-[2-[3-(trifluoromethyl)anilino]ethyl]propanamide |
| SMILES | Cc1ccc2[nH]c3c(=O)n(CCC(=O)NCCNc4cccc(C(F)(F)F)c4)cnc3c2c1 |
| InChI | InChI=1S/C23H22F3N5O2/c1-14-5-6-18-17(11-14)20-21(30-18)22(33)31(13-29-20)10-7-19(32)28-9-8-27-16-4-2-3-15(12-16)23(24,25)26/h2-6,11-13,27,30H,7-10H2,1H3,(H,28,32) |
| InChIKey | KYVAUINXKOMMTH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|