C16H17FN4O3 — CID 18525606
3-(8-fluoro-4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(2-methoxyethyl)propanamide (PubChem CID 18525606) has the molecular formula C16H17FN4O3 and a molecular weight of 332.34 g/mol. Its IUPAC name is 3-(8-fluoro-4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-(8-fluoro-4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 18525606 |
| Molecular Formula | C16H17FN4O3 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-(8-fluoro-4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCn1cnc2c([nH]c3ccc(F)cc32)c1=O |
| InChI | InChI=1S/C16H17FN4O3/c1-24-7-5-18-13(22)4-6-21-9-19-14-11-8-10(17)2-3-12(11)20-15(14)16(21)23/h2-3,8-9,20H,4-7H2,1H3,(H,18,22) |
| InChIKey | ZFLNDJMGXXKRFC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|