C15H15BrN4O3 — CID 18525583
2-(8-bromo-4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(2-methoxyethyl)acetamide (PubChem CID 18525583) has the molecular formula C15H15BrN4O3 and a molecular weight of 379.21 g/mol. Its IUPAC name is 2-(8-bromo-4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(8-bromo-4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 18525583 |
| Molecular Formula | C15H15BrN4O3 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 2-(8-bromo-4-oxo-5H-pyrimido[5,4-b]indol-3-yl)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cn1cnc2c([nH]c3ccc(Br)cc32)c1=O |
| InChI | InChI=1S/C15H15BrN4O3/c1-23-5-4-17-12(21)7-20-8-18-13-10-6-9(16)2-3-11(10)19-14(13)15(20)22/h2-3,6,8,19H,4-5,7H2,1H3,(H,17,21) |
| InChIKey | FHGBHOCLHMCIOM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|