C12H13FN4O — CID 170726455
13-ethyl-3-fluoro-7-methyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene (PubChem CID 170726455) has the molecular formula C12H13FN4O and a molecular weight of 248.26 g/mol. Its IUPAC name is 13-ethyl-3-fluoro-7-methyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene.
| Compound Name | 13-ethyl-3-fluoro-7-methyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
|---|---|
| PubChem CID | 170726455 |
| Molecular Formula | C12H13FN4O |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 13-ethyl-3-fluoro-7-methyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
| SMILES | CCN1CCOc2nc(C)cc3nc(F)nc1c23 |
| InChI | InChI=1S/C12H13FN4O/c1-3-17-4-5-18-11-9-8(6-7(2)14-11)15-12(13)16-10(9)17/h6H,3-5H2,1-2H3 |
| InChIKey | BPDPNECNFDQQFU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |