C15H16ClFN4OS — CID 170726961
12-chloro-13-fluoro-16-methylsulfanyl-2,11,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaen-8-ol (PubChem CID 170726961) has the molecular formula C15H16ClFN4OS and a molecular weight of 354.84 g/mol. Its IUPAC name is 12-chloro-13-fluoro-16-methylsulfanyl-2,11,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaen-8-ol.
| Compound Name | 12-chloro-13-fluoro-16-methylsulfanyl-2,11,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaen-8-ol |
|---|---|
| PubChem CID | 170726961 |
| Molecular Formula | C15H16ClFN4OS |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 12-chloro-13-fluoro-16-methylsulfanyl-2,11,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaen-8-ol |
| SMILES | CSc1nc2c3c(nc(Cl)c(F)c3n1)CC(O)C1CCCCN21 |
| InChI | InChI=1S/C15H16ClFN4OS/c1-23-15-19-12-10-7(18-13(16)11(12)17)6-9(22)8-4-2-3-5-21(8)14(10)20-15/h8-9,22H,2-6H2,1H3 |
| InChIKey | OXDVOCASRYWHRA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|