C14H15Cl2FN4OS — CID 170554032
1-(5,7-dichloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol (PubChem CID 170554032) has the molecular formula C14H15Cl2FN4OS and a molecular weight of 377.27 g/mol. Its IUPAC name is 1-(5,7-dichloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol.
| Compound Name | 1-(5,7-dichloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 170554032 |
| Molecular Formula | C14H15Cl2FN4OS |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 1-(5,7-dichloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol |
| SMILES | CSc1nc(N2CCCC(C)(O)C2)c2c(Cl)nc(Cl)c(F)c2n1 |
| InChI | InChI=1S/C14H15Cl2FN4OS/c1-14(22)4-3-5-21(6-14)12-7-9(18-13(20-12)23-2)8(17)11(16)19-10(7)15/h22H,3-6H2,1-2H3 |
| InChIKey | NSRJIECPHLOHGD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|