C14H16ClFN4O — CID 164534563
1-(7-chloro-8-fluoro-2-methylpyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol (PubChem CID 164534563) has the molecular formula C14H16ClFN4O and a molecular weight of 310.76 g/mol. Its IUPAC name is 1-(7-chloro-8-fluoro-2-methylpyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol.
| Compound Name | 1-(7-chloro-8-fluoro-2-methylpyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 164534563 |
| Molecular Formula | C14H16ClFN4O |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-(7-chloro-8-fluoro-2-methylpyrido[4,3-d]pyrimidin-4-yl)-3-methylpiperidin-3-ol |
| SMILES | Cc1nc(N2CCCC(C)(O)C2)c2cnc(Cl)c(F)c2n1 |
| InChI | InChI=1S/C14H16ClFN4O/c1-8-18-11-9(6-17-12(15)10(11)16)13(19-8)20-5-3-4-14(2,21)7-20/h6,21H,3-5,7H2,1-2H3 |
| InChIKey | RDYSGZSQVBMIHA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|