C27H26FNO3 — CID 170728488
1-[2-fluoro-4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenyl]piperidine-4-carbaldehyde (PubChem CID 170728488) has the molecular formula C27H26FNO3 and a molecular weight of 431.51 g/mol. Its IUPAC name is 1-[2-fluoro-4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[2-fluoro-4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 170728488 |
| Molecular Formula | C27H26FNO3 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 1-[2-fluoro-4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenyl]piperidine-4-carbaldehyde |
| SMILES | O=CC1CCN(c2ccc([C@@H]3c4ccc(O)cc4OC[C@@H]3c3ccccc3)cc2F)CC1 |
| InChI | InChI=1S/C27H26FNO3/c28-24-14-20(6-9-25(24)29-12-10-18(16-30)11-13-29)27-22-8-7-21(31)15-26(22)32-17-23(27)19-4-2-1-3-5-19/h1-9,14-16,18,23,27,31H,10-13,17H2/t23-,27-/m1/s1 |
| InChIKey | LZMIIIKQVXFHOS-YIXXDRMTSA-N |
| XLogP | 5.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|