C19H23FN4O3 — CID 170731235
tert-butyl N-[2-acetamido-5-[5-(1-fluoroethyl)-2-pyridinyl]-4-pyridinyl]carbamate (PubChem CID 170731235) has the molecular formula C19H23FN4O3 and a molecular weight of 374.42 g/mol. Its IUPAC name is tert-butyl N-[2-acetamido-5-[5-(1-fluoroethyl)-2-pyridinyl]-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-acetamido-5-[5-(1-fluoroethyl)-2-pyridinyl]-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 170731235 |
| Molecular Formula | C19H23FN4O3 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | tert-butyl N-[2-acetamido-5-[5-(1-fluoroethyl)-2-pyridinyl]-4-pyridinyl]carbamate |
| SMILES | CC(=O)Nc1cc(NC(=O)OC(C)(C)C)c(-c2ccc(C(C)F)cn2)cn1 |
| InChI | InChI=1S/C19H23FN4O3/c1-11(20)13-6-7-15(21-9-13)14-10-22-17(23-12(2)25)8-16(14)24-18(26)27-19(3,4)5/h6-11H,1-5H3,(H2,22,23,24,25,26) |
| InChIKey | XMTBVUADLQKZIR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |