C15H21N3O5 — CID 170731023
tert-butyl N-[2-acetamido-5-(oxetan-3-yloxy)-4-pyridinyl]carbamate (PubChem CID 170731023) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is tert-butyl N-[2-acetamido-5-(oxetan-3-yloxy)-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-acetamido-5-(oxetan-3-yloxy)-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 170731023 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | tert-butyl N-[2-acetamido-5-(oxetan-3-yloxy)-4-pyridinyl]carbamate |
| SMILES | CC(=O)Nc1cc(NC(=O)OC(C)(C)C)c(OC2COC2)cn1 |
| InChI | InChI=1S/C15H21N3O5/c1-9(19)17-13-5-11(18-14(20)23-15(2,3)4)12(6-16-13)22-10-7-21-8-10/h5-6,10H,7-8H2,1-4H3,(H2,16,17,18,19,20) |
| InChIKey | KXTYCPWZAQEILV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |