C15H30N2 — CID 170732049
ethane;3-N-ethyl-2-propan-2-ylidenepentane-1,3-diimine;prop-1-ene (PubChem CID 170732049) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is ethane;3-N-ethyl-2-propan-2-ylidenepentane-1,3-diimine;prop-1-ene.
| Compound Name | ethane;3-N-ethyl-2-propan-2-ylidenepentane-1,3-diimine;prop-1-ene |
|---|---|
| PubChem CID | 170732049 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | ethane;3-N-ethyl-2-propan-2-ylidenepentane-1,3-diimine;prop-1-ene |
| SMILES | C=CC.CC.[H]/N=C/C(=C(C)C)/C(CC)=N/CC |
| InChI | InChI=1S/C10H18N2.C3H6.C2H6/c1-5-10(12-6-2)9(7-11)8(3)4;1-3-2;1-2/h7,11H,5-6H2,1-4H3;3H,1H2,2H3;1-2H3/b11-7+,12-10+;; |
| InChIKey | SZXVYKDQMGQMRH-OGZWAGIISA-N |
| XLogP | 5.06 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|