About [(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]methanediamine
[(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]methanediamine (PubChem CID 118719543) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is [(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]methanediamine.
Molecular Properties
| Compound Name | [(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]methanediamine |
| PubChem CID | 118719543 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | [(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]methanediamine |
| SMILES | CC(C)=CCC/C(C)=C/C=N/C(N)N |
| InChI | InChI=1S/C11H21N3/c1-9(2)5-4-6-10(3)7-8-14-11(12)13/h5,7-8,11H,4,6,12-13H2,1-3H3/b10-7+,14-8+ |
| InChIKey | WAVHCFLKKMIHPX-XFUBVATKSA-N |
| XLogP | 1.95 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]methanediamine?
The IUPAC name of [(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]methanediamine (CID 118719543) is [(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]methanediamine.
What is the SMILES notation for [(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]methanediamine?
The canonical SMILES for [(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]methanediamine is CC(C)=CCC/C(C)=C/C=N/C(N)N.
What is the InChIKey of [(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]methanediamine?
The InChIKey is WAVHCFLKKMIHPX-XFUBVATKSA-N. The full InChI is InChI=1S/C11H21N3/c1-9(2)5-4-6-10(3)7-8-14-11(12)13/h5,7-8,11H,4,6,12-13H2,1-3H3/b10-7+,14-8+.
What are the key properties of [(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]methanediamine?
[(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]methanediamine has a molecular weight of 195.31 g/mol, XLogP of 1.95, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]methanediamine is sourced from PubChem (CID 118719543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).