C9H11Br2N3 — CID 170732232
N'-(3,5-dibromo-4-methyl-2-pyridinyl)-N,N-dimethylmethanimidamide (PubChem CID 170732232) has the molecular formula C9H11Br2N3 and a molecular weight of 321.02 g/mol. Its IUPAC name is N'-(3,5-dibromo-4-methyl-2-pyridinyl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(3,5-dibromo-4-methyl-2-pyridinyl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 170732232 |
| Molecular Formula | C9H11Br2N3 |
| Molecular Weight | 321.02 g/mol |
| Exact Mass | 318.93 |
| IUPAC Name | N'-(3,5-dibromo-4-methyl-2-pyridinyl)-N,N-dimethylmethanimidamide |
| SMILES | Cc1c(Br)cnc(/N=C/N(C)C)c1Br |
| InChI | InChI=1S/C9H11Br2N3/c1-6-7(10)4-12-9(8(6)11)13-5-14(2)3/h4-5H,1-3H3/b13-5+ |
| InChIKey | VSWSNGSUJWAWHH-WLRTZDKTSA-N |
| XLogP | 3.14 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.02 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|