C19H25N — CID 170732956
7-ethyl-9-methyl-9,10-dihydrobenzo[h]quinoline;propane (PubChem CID 170732956) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 7-ethyl-9-methyl-9,10-dihydrobenzo[h]quinoline;propane.
| Compound Name | 7-ethyl-9-methyl-9,10-dihydrobenzo[h]quinoline;propane |
|---|---|
| PubChem CID | 170732956 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 7-ethyl-9-methyl-9,10-dihydrobenzo[h]quinoline;propane |
| SMILES | CCC.CCC1=CC(C)Cc2c1ccc1cccnc21 |
| InChI | InChI=1S/C16H17N.C3H8/c1-3-12-9-11(2)10-15-14(12)7-6-13-5-4-8-17-16(13)15;1-3-2/h4-9,11H,3,10H2,1-2H3;3H2,1-2H3 |
| InChIKey | ODZXKAHPCKZWDW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |