C19H20N2O4 — CID 170735485
ethyl 4-[1-(4-ethynylphenyl)ethoxy]-5-(methylcarbamoyl)-1H-pyrrole-2-carboxylate (PubChem CID 170735485) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is ethyl 4-[1-(4-ethynylphenyl)ethoxy]-5-(methylcarbamoyl)-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[1-(4-ethynylphenyl)ethoxy]-5-(methylcarbamoyl)-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 170735485 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | ethyl 4-[1-(4-ethynylphenyl)ethoxy]-5-(methylcarbamoyl)-1H-pyrrole-2-carboxylate |
| SMILES | C#Cc1ccc(C(C)Oc2cc(C(=O)OCC)[nH]c2C(=O)NC)cc1 |
| InChI | InChI=1S/C19H20N2O4/c1-5-13-7-9-14(10-8-13)12(3)25-16-11-15(19(23)24-6-2)21-17(16)18(22)20-4/h1,7-12,21H,6H2,2-4H3,(H,20,22) |
| InChIKey | VFGIYOUNGCDORY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|