C28H37ClF2N8O3 — CID 170736693
3-[7-[[5-chloro-2-[(3R,5S)-4,4-difluoro-3,5-dimethylpiperidin-1-yl]pyrimidin-4-yl]amino]-4-methyl-2,3-dioxoquinoxalin-1-yl]-N-[3-(dimethylamino)propyl]propanamide (PubChem CID 170736693) has the molecular formula C28H37ClF2N8O3 and a molecular weight of 607.11 g/mol. Its IUPAC name is 3-[7-[[5-chloro-2-[(3R,5S)-4,4-difluoro-3,5-dimethylpiperidin-1-yl]pyrimidin-4-yl]amino]-4-methyl-2,3-dioxoquinoxalin-1-yl]-N-[3-(dimethylamino)propyl]propanamide.
| Compound Name | 3-[7-[[5-chloro-2-[(3R,5S)-4,4-difluoro-3,5-dimethylpiperidin-1-yl]pyrimidin-4-yl]amino]-4-methyl-2,3-dioxoquinoxalin-1-yl]-N-[3-(dimethylamino)propyl]propanamide |
|---|---|
| PubChem CID | 170736693 |
| Molecular Formula | C28H37ClF2N8O3 |
| Molecular Weight | 607.11 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | 3-[7-[[5-chloro-2-[(3R,5S)-4,4-difluoro-3,5-dimethylpiperidin-1-yl]pyrimidin-4-yl]amino]-4-methyl-2,3-dioxoquinoxalin-1-yl]-N-[3-(dimethylamino)propyl]propanamide |
| SMILES | C[C@@H]1CN(c2ncc(Cl)c(Nc3ccc4c(c3)n(CCC(=O)NCCCN(C)C)c(=O)c(=O)n4C)n2)C[C@H](C)C1(F)F |
| InChI | InChI=1S/C28H37ClF2N8O3/c1-17-15-38(16-18(2)28(17,30)31)27-33-14-20(29)24(35-27)34-19-7-8-21-22(13-19)39(26(42)25(41)37(21)5)12-9-23(40)32-10-6-11-36(3)4/h7-8,13-14,17-18H,6,9-12,15-16H2,1-5H3,(H,32,40)(H,33,34,35)/t17-,18+ |
| InChIKey | KYMBBRFNTWIRFJ-HDICACEKSA-N |
| XLogP | 3.07 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.11 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|