C26H32ClF2N7O4 — CID 170736769
6-[[5-chloro-2-[(3R,5S)-4,4-difluoro-3,5-dimethylpiperidin-1-yl]pyrimidin-4-yl]amino]-4-[3-hydroxy-3-(oxetan-3-ylamino)propyl]-1-methylquinoxaline-2,3-dione (PubChem CID 170736769) has the molecular formula C26H32ClF2N7O4 and a molecular weight of 580.04 g/mol. Its IUPAC name is 6-[[5-chloro-2-[(3R,5S)-4,4-difluoro-3,5-dimethylpiperidin-1-yl]pyrimidin-4-yl]amino]-4-[3-hydroxy-3-(oxetan-3-ylamino)propyl]-1-methylquinoxaline-2,3-dione.
| Compound Name | 6-[[5-chloro-2-[(3R,5S)-4,4-difluoro-3,5-dimethylpiperidin-1-yl]pyrimidin-4-yl]amino]-4-[3-hydroxy-3-(oxetan-3-ylamino)propyl]-1-methylquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 170736769 |
| Molecular Formula | C26H32ClF2N7O4 |
| Molecular Weight | 580.04 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | 6-[[5-chloro-2-[(3R,5S)-4,4-difluoro-3,5-dimethylpiperidin-1-yl]pyrimidin-4-yl]amino]-4-[3-hydroxy-3-(oxetan-3-ylamino)propyl]-1-methylquinoxaline-2,3-dione |
| SMILES | C[C@@H]1CN(c2ncc(Cl)c(Nc3ccc4c(c3)n(CCC(O)NC3COC3)c(=O)c(=O)n4C)n2)C[C@H](C)C1(F)F |
| InChI | InChI=1S/C26H32ClF2N7O4/c1-14-10-35(11-15(2)26(14,28)29)25-30-9-18(27)22(33-25)32-16-4-5-19-20(8-16)36(24(39)23(38)34(19)3)7-6-21(37)31-17-12-40-13-17/h4-5,8-9,14-15,17,21,31,37H,6-7,10-13H2,1-3H3,(H,30,32,33)/t14-,15+,21? |
| InChIKey | ZBGPWFJIBKYJJZ-YLQYIJTPSA-N |
| XLogP | 2.31 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.04 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|