C16H20N4O3 — CID 170737594
N-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperidine-4-carboxamide (PubChem CID 170737594) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is N-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperidine-4-carboxamide.
| Compound Name | N-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 170737594 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperidine-4-carboxamide |
| SMILES | O=C1CCN(c2ccc(NC(=O)C3CCNCC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C16H20N4O3/c21-14-7-10-20(16(23)19-14)13-3-1-12(2-4-13)18-15(22)11-5-8-17-9-6-11/h1-4,11,17H,5-10H2,(H,18,22)(H,19,21,23) |
| InChIKey | JJJWGANYDVPIAK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |