C15H10N8O — CID 170737644
1-[4-(cyanomethylamino)-5-[(E)-hydroxyiminomethyl]-2-pyridinyl]pyrazolo[5,4-b]pyridine-5-carbonitrile (PubChem CID 170737644) has the molecular formula C15H10N8O and a molecular weight of 318.30 g/mol. Its IUPAC name is 1-[4-(cyanomethylamino)-5-[(E)-hydroxyiminomethyl]-2-pyridinyl]pyrazolo[5,4-b]pyridine-5-carbonitrile.
| Compound Name | 1-[4-(cyanomethylamino)-5-[(E)-hydroxyiminomethyl]-2-pyridinyl]pyrazolo[5,4-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 170737644 |
| Molecular Formula | C15H10N8O |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-[4-(cyanomethylamino)-5-[(E)-hydroxyiminomethyl]-2-pyridinyl]pyrazolo[5,4-b]pyridine-5-carbonitrile |
| SMILES | N#CCNc1cc(-n2ncc3cc(C#N)cnc32)ncc1/C=N/O |
| InChI | InChI=1S/C15H10N8O/c16-1-2-18-13-4-14(19-7-12(13)9-22-24)23-15-11(8-21-23)3-10(5-17)6-20-15/h3-4,6-9,24H,2H2,(H,18,19)/b22-9+ |
| InChIKey | XSVJMAXJBXPAAT-LSFURLLWSA-N |
| XLogP | 1.43 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|