C20H19N4O2S2+ — CID 170737950
4-[3-amino-2-(2-methoxyethylsulfanyl)-4-phenylthieno[2,3-b]pyridin-6-yl]-1H-pyrimidin-3-ium-6-one (PubChem CID 170737950) has the molecular formula C20H19N4O2S2+ and a molecular weight of 411.53 g/mol. Its IUPAC name is 4-[3-amino-2-(2-methoxyethylsulfanyl)-4-phenylthieno[2,3-b]pyridin-6-yl]-1H-pyrimidin-3-ium-6-one.
| Compound Name | 4-[3-amino-2-(2-methoxyethylsulfanyl)-4-phenylthieno[2,3-b]pyridin-6-yl]-1H-pyrimidin-3-ium-6-one |
|---|---|
| PubChem CID | 170737950 |
| Molecular Formula | C20H19N4O2S2+ |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 4-[3-amino-2-(2-methoxyethylsulfanyl)-4-phenylthieno[2,3-b]pyridin-6-yl]-1H-pyrimidin-3-ium-6-one |
| SMILES | COCCSc1sc2nc(-c3cc(=O)[nH]c[nH+]3)cc(-c3ccccc3)c2c1N |
| InChI | InChI=1S/C20H18N4O2S2/c1-26-7-8-27-20-18(21)17-13(12-5-3-2-4-6-12)9-15(24-19(17)28-20)14-10-16(25)23-11-22-14/h2-6,9-11H,7-8,21H2,1H3,(H,22,23,25)/p+1 |
| InChIKey | JFFVYQOTBLAHPE-UHFFFAOYSA-O |
| XLogP | 3.45 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|