C12H20F3N — CID 170739932
2-ethyl-6-(3,3,3-trifluoropropyl)-6-azaspiro[3.4]octane (PubChem CID 170739932) has the molecular formula C12H20F3N and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-ethyl-6-(3,3,3-trifluoropropyl)-6-azaspiro[3.4]octane.
| Compound Name | 2-ethyl-6-(3,3,3-trifluoropropyl)-6-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 170739932 |
| Molecular Formula | C12H20F3N |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 2-ethyl-6-(3,3,3-trifluoropropyl)-6-azaspiro[3.4]octane |
| SMILES | CCC1CC2(CCN(CCC(F)(F)F)C2)C1 |
| InChI | InChI=1S/C12H20F3N/c1-2-10-7-11(8-10)3-5-16(9-11)6-4-12(13,14)15/h10H,2-9H2,1H3 |
| InChIKey | CWXIHIORVSOMRF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |