C19H19N3O2 — CID 170742408
(5R)-5-[2-(1H-indol-3-yl)ethyl]-5,6,7,8-tetrahydro-[1,3,2]dioxazolo[4,5-g]isoquinoline (PubChem CID 170742408) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is (5R)-5-[2-(1H-indol-3-yl)ethyl]-5,6,7,8-tetrahydro-[1,3,2]dioxazolo[4,5-g]isoquinoline.
| Compound Name | (5R)-5-[2-(1H-indol-3-yl)ethyl]-5,6,7,8-tetrahydro-[1,3,2]dioxazolo[4,5-g]isoquinoline |
|---|---|
| PubChem CID | 170742408 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (5R)-5-[2-(1H-indol-3-yl)ethyl]-5,6,7,8-tetrahydro-[1,3,2]dioxazolo[4,5-g]isoquinoline |
| SMILES | c1ccc2c(CC[C@H]3NCCc4cc5c(cc43)ONO5)c[nH]c2c1 |
| InChI | InChI=1S/C19H19N3O2/c1-2-4-16-14(3-1)13(11-21-16)5-6-17-15-10-19-18(23-22-24-19)9-12(15)7-8-20-17/h1-4,9-11,17,20-22H,5-8H2/t17-/m1/s1 |
| InChIKey | JHTJWRJFZUQKMF-QGZVFWFLSA-N |
| XLogP | 3.18 |
| TPSA | 58.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |