C18H27N2+ — CID 6935303
cyclooctyl-[2-(1H-indol-3-yl)ethyl]azanium (PubChem CID 6935303) has the molecular formula C18H27N2+ and a molecular weight of 271.43 g/mol. Its IUPAC name is cyclooctyl-[2-(1H-indol-3-yl)ethyl]azanium.
| Compound Name | cyclooctyl-[2-(1H-indol-3-yl)ethyl]azanium |
|---|---|
| PubChem CID | 6935303 |
| Molecular Formula | C18H27N2+ |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.22 |
| IUPAC Name | cyclooctyl-[2-(1H-indol-3-yl)ethyl]azanium |
| SMILES | c1ccc2c(CC[NH2+]C3CCCCCCC3)c[nH]c2c1 |
| InChI | InChI=1S/C18H26N2/c1-2-4-8-16(9-5-3-1)19-13-12-15-14-20-18-11-7-6-10-17(15)18/h6-7,10-11,14,16,19-20H,1-5,8-9,12-13H2/p+1 |
| InChIKey | GGLPSVYDFTWWMV-UHFFFAOYSA-O |
| XLogP | 3.39 |
| TPSA | 32.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |