C17H25N2+ — CID 7445932
2-(1H-indol-3-yl)ethyl-[(1R,3R)-3-methylcyclohexyl]azanium (PubChem CID 7445932) has the molecular formula C17H25N2+ and a molecular weight of 257.40 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)ethyl-[(1R,3R)-3-methylcyclohexyl]azanium.
| Compound Name | 2-(1H-indol-3-yl)ethyl-[(1R,3R)-3-methylcyclohexyl]azanium |
|---|---|
| PubChem CID | 7445932 |
| Molecular Formula | C17H25N2+ |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | 2-(1H-indol-3-yl)ethyl-[(1R,3R)-3-methylcyclohexyl]azanium |
| SMILES | C[C@@H]1CCC[C@@H]([NH2+]CCc2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C17H24N2/c1-13-5-4-6-15(11-13)18-10-9-14-12-19-17-8-3-2-7-16(14)17/h2-3,7-8,12-13,15,18-19H,4-6,9-11H2,1H3/p+1/t13-,15-/m1/s1 |
| InChIKey | CAKPKLPFTPLQEJ-UKRRQHHQSA-O |
| XLogP | 2.85 |
| TPSA | 32.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |