About 1-(9-bromononoxy)octan-1-ol;hexane-1-thiol
1-(9-bromononoxy)octan-1-ol;hexane-1-thiol (PubChem CID 170743019) has the molecular formula C23H49BrO2S
and a molecular weight of 469.61 g/mol. Its IUPAC name is 1-(9-bromononoxy)octan-1-ol;hexane-1-thiol.
Molecular Properties
| Compound Name | 1-(9-bromononoxy)octan-1-ol;hexane-1-thiol |
| PubChem CID | 170743019 |
| Molecular Formula | C23H49BrO2S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 1-(9-bromononoxy)octan-1-ol;hexane-1-thiol |
| SMILES | CCCCCCCC(O)OCCCCCCCCCBr.CCCCCCS |
| InChI | InChI=1S/C17H35BrO2.C6H14S/c1-2-3-4-8-11-14-17(19)20-16-13-10-7-5-6-9-12-15-18;1-2-3-4-5-6-7/h17,19H,2-16H2,1H3;7H,2-6H2,1H3 |
| InChIKey | DLAUEWGPIXEDPZ-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(9-bromononoxy)octan-1-ol;hexane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(9-bromononoxy)octan-1-ol;hexane-1-thiol?
The IUPAC name of 1-(9-bromononoxy)octan-1-ol;hexane-1-thiol (CID 170743019) is 1-(9-bromononoxy)octan-1-ol;hexane-1-thiol.
What is the SMILES notation for 1-(9-bromononoxy)octan-1-ol;hexane-1-thiol?
The canonical SMILES for 1-(9-bromononoxy)octan-1-ol;hexane-1-thiol is CCCCCCCC(O)OCCCCCCCCCBr.CCCCCCS.
What is the InChIKey of 1-(9-bromononoxy)octan-1-ol;hexane-1-thiol?
The InChIKey is DLAUEWGPIXEDPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35BrO2.C6H14S/c1-2-3-4-8-11-14-17(19)20-16-13-10-7-5-6-9-12-15-18;1-2-3-4-5-6-7/h17,19H,2-16H2,1H3;7H,2-6H2,1H3.
What are the key properties of 1-(9-bromononoxy)octan-1-ol;hexane-1-thiol?
1-(9-bromononoxy)octan-1-ol;hexane-1-thiol has a molecular weight of 469.61 g/mol, XLogP of 8.30, 20 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(9-bromononoxy)octan-1-ol;hexane-1-thiol is sourced from PubChem (CID 170743019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).