C12H15BrO3S — CID 170744006
2-bromo-4-(cyclobutylmethylsulfonyl)-1-methoxybenzene (PubChem CID 170744006) has the molecular formula C12H15BrO3S and a molecular weight of 319.22 g/mol. Its IUPAC name is 2-bromo-4-(cyclobutylmethylsulfonyl)-1-methoxybenzene.
| Compound Name | 2-bromo-4-(cyclobutylmethylsulfonyl)-1-methoxybenzene |
|---|---|
| PubChem CID | 170744006 |
| Molecular Formula | C12H15BrO3S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 2-bromo-4-(cyclobutylmethylsulfonyl)-1-methoxybenzene |
| SMILES | COc1ccc(S(=O)(=O)CC2CCC2)cc1Br |
| InChI | InChI=1S/C12H15BrO3S/c1-16-12-6-5-10(7-11(12)13)17(14,15)8-9-3-2-4-9/h5-7,9H,2-4,8H2,1H3 |
| InChIKey | NRPUYXRRYUDVEJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |