C11H16O4 — CID 170746409
1-(4,5,6-trimethoxycyclohexa-2,4-dien-1-yl)ethanone (PubChem CID 170746409) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 1-(4,5,6-trimethoxycyclohexa-2,4-dien-1-yl)ethanone.
| Compound Name | 1-(4,5,6-trimethoxycyclohexa-2,4-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 170746409 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 1-(4,5,6-trimethoxycyclohexa-2,4-dien-1-yl)ethanone |
| SMILES | COC1=C(OC)C(OC)C(C(C)=O)C=C1 |
| InChI | InChI=1S/C11H16O4/c1-7(12)8-5-6-9(13-2)11(15-4)10(8)14-3/h5-6,8,10H,1-4H3 |
| InChIKey | ADYHXUVFKCHFCA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |