C17H13ClFN3O — CID 170746530
4-(2-chloro-3-fluoro-4-methylphenoxy)-N-pyridin-2-ylpyridin-2-amine (PubChem CID 170746530) has the molecular formula C17H13ClFN3O and a molecular weight of 329.76 g/mol. Its IUPAC name is 4-(2-chloro-3-fluoro-4-methylphenoxy)-N-pyridin-2-ylpyridin-2-amine.
| Compound Name | 4-(2-chloro-3-fluoro-4-methylphenoxy)-N-pyridin-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 170746530 |
| Molecular Formula | C17H13ClFN3O |
| Molecular Weight | 329.76 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 4-(2-chloro-3-fluoro-4-methylphenoxy)-N-pyridin-2-ylpyridin-2-amine |
| SMILES | Cc1ccc(Oc2ccnc(Nc3ccccn3)c2)c(Cl)c1F |
| InChI | InChI=1S/C17H13ClFN3O/c1-11-5-6-13(16(18)17(11)19)23-12-7-9-21-15(10-12)22-14-4-2-3-8-20-14/h2-10H,1H3,(H,20,21,22) |
| InChIKey | RQVSPMVJJNHXSS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.76 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |