C18H15FN2O — CID 170746492
4-(3-fluoro-4-methylphenoxy)-N-phenylpyridin-2-amine (PubChem CID 170746492) has the molecular formula C18H15FN2O and a molecular weight of 294.33 g/mol. Its IUPAC name is 4-(3-fluoro-4-methylphenoxy)-N-phenylpyridin-2-amine.
| Compound Name | 4-(3-fluoro-4-methylphenoxy)-N-phenylpyridin-2-amine |
|---|---|
| PubChem CID | 170746492 |
| Molecular Formula | C18H15FN2O |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-(3-fluoro-4-methylphenoxy)-N-phenylpyridin-2-amine |
| SMILES | Cc1ccc(Oc2ccnc(Nc3ccccc3)c2)cc1F |
| InChI | InChI=1S/C18H15FN2O/c1-13-7-8-15(11-17(13)19)22-16-9-10-20-18(12-16)21-14-5-3-2-4-6-14/h2-12H,1H3,(H,20,21) |
| InChIKey | SONYNFHDTSSLNX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |