C16H20FNO — CID 170747048
2-[(2,4-dimethylphenoxy)methyl]-6-fluoropyridine;ethane (PubChem CID 170747048) has the molecular formula C16H20FNO and a molecular weight of 261.34 g/mol. Its IUPAC name is 2-[(2,4-dimethylphenoxy)methyl]-6-fluoropyridine;ethane.
| Compound Name | 2-[(2,4-dimethylphenoxy)methyl]-6-fluoropyridine;ethane |
|---|---|
| PubChem CID | 170747048 |
| Molecular Formula | C16H20FNO |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-[(2,4-dimethylphenoxy)methyl]-6-fluoropyridine;ethane |
| SMILES | CC.Cc1ccc(OCc2cccc(F)n2)c(C)c1 |
| InChI | InChI=1S/C14H14FNO.C2H6/c1-10-6-7-13(11(2)8-10)17-9-12-4-3-5-14(15)16-12;1-2/h3-8H,9H2,1-2H3;1-2H3 |
| InChIKey | PITXWWHVDJBEDU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|