C25H30FN5OS — CID 170747672
2-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-6-(2,2,6,6-tetramethylpiperidin-4-yl)thieno[2,3-b]pyridine;formamide (PubChem CID 170747672) has the molecular formula C25H30FN5OS and a molecular weight of 467.61 g/mol. Its IUPAC name is 2-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-6-(2,2,6,6-tetramethylpiperidin-4-yl)thieno[2,3-b]pyridine;formamide.
| Compound Name | 2-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-6-(2,2,6,6-tetramethylpiperidin-4-yl)thieno[2,3-b]pyridine;formamide |
|---|---|
| PubChem CID | 170747672 |
| Molecular Formula | C25H30FN5OS |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 2-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-6-(2,2,6,6-tetramethylpiperidin-4-yl)thieno[2,3-b]pyridine;formamide |
| SMILES | Cc1cn2cc(-c3cc4ccc(C5CC(C)(C)NC(C)(C)C5)nc4s3)cc(F)c2n1.NC=O |
| InChI | InChI=1S/C24H27FN4S.CH3NO/c1-14-12-29-13-16(8-18(25)21(29)26-14)20-9-15-6-7-19(27-22(15)30-20)17-10-23(2,3)28-24(4,5)11-17;2-1-3/h6-9,12-13,17,28H,10-11H2,1-5H3;1H,(H2,2,3) |
| InChIKey | MKMOMFWSSISDHP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|