C15H22N4OS — CID 170747736
N,N-dimethyl-1-(2-methylthieno[2,3-b]pyridin-6-yl)pyrrolidin-3-amine;formamide (PubChem CID 170747736) has the molecular formula C15H22N4OS and a molecular weight of 306.44 g/mol. Its IUPAC name is N,N-dimethyl-1-(2-methylthieno[2,3-b]pyridin-6-yl)pyrrolidin-3-amine;formamide.
| Compound Name | N,N-dimethyl-1-(2-methylthieno[2,3-b]pyridin-6-yl)pyrrolidin-3-amine;formamide |
|---|---|
| PubChem CID | 170747736 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N,N-dimethyl-1-(2-methylthieno[2,3-b]pyridin-6-yl)pyrrolidin-3-amine;formamide |
| SMILES | Cc1cc2ccc(N3CCC(N(C)C)C3)nc2s1.NC=O |
| InChI | InChI=1S/C14H19N3S.CH3NO/c1-10-8-11-4-5-13(15-14(11)18-10)17-7-6-12(9-17)16(2)3;2-1-3/h4-5,8,12H,6-7,9H2,1-3H3;1H,(H2,2,3) |
| InChIKey | ZEUNZTZDALRPSM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|