C15H21N3OS — CID 177202390
formamide;2-methyl-6-(1-methylpiperidin-3-yl)thieno[2,3-b]pyridine (PubChem CID 177202390) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is formamide;2-methyl-6-(1-methylpiperidin-3-yl)thieno[2,3-b]pyridine.
| Compound Name | formamide;2-methyl-6-(1-methylpiperidin-3-yl)thieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 177202390 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | formamide;2-methyl-6-(1-methylpiperidin-3-yl)thieno[2,3-b]pyridine |
| SMILES | Cc1cc2ccc(C3CCCN(C)C3)nc2s1.NC=O |
| InChI | InChI=1S/C14H18N2S.CH3NO/c1-10-8-11-5-6-13(15-14(11)17-10)12-4-3-7-16(2)9-12;2-1-3/h5-6,8,12H,3-4,7,9H2,1-2H3;1H,(H2,2,3) |
| InChIKey | JANWDJJCNMUKJZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|