C11H16N2OS — CID 131297673
4-methyl-2-(1-methylpiperidin-3-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 131297673) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 4-methyl-2-(1-methylpiperidin-3-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-methyl-2-(1-methylpiperidin-3-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 131297673 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 4-methyl-2-(1-methylpiperidin-3-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | Cc1nc(C2CCCN(C)C2)sc1C=O |
| InChI | InChI=1S/C11H16N2OS/c1-8-10(7-14)15-11(12-8)9-4-3-5-13(2)6-9/h7,9H,3-6H2,1-2H3 |
| InChIKey | GOLHTWLYQQFQDX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|