C15H22N2O3S — CID 87553401
2-tert-butyl-4-(5-formyl-4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxylic acid (PubChem CID 87553401) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-tert-butyl-4-(5-formyl-4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-4-(5-formyl-4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87553401 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-tert-butyl-4-(5-formyl-4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxylic acid |
| SMILES | Cc1nc(C2CCN(C(=O)O)C(C(C)(C)C)C2)sc1C=O |
| InChI | InChI=1S/C15H22N2O3S/c1-9-11(8-18)21-13(16-9)10-5-6-17(14(19)20)12(7-10)15(2,3)4/h8,10,12H,5-7H2,1-4H3,(H,19,20) |
| InChIKey | UVTYZEVRFVMKOA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|