C37H48FN7O5S — CID 170748898
(3S)-3-[4-[4-[2-[4-[[5-fluoro-2-(oxan-4-ylsulfanylmethyl)-4-oxo-3H-quinazolin-7-yl]oxymethyl]piperidin-1-yl]ethyl]piperazin-1-yl]anilino]piperidine-2,6-dione (PubChem CID 170748898) has the molecular formula C37H48FN7O5S and a molecular weight of 721.90 g/mol. Its IUPAC name is (3S)-3-[4-[4-[2-[4-[[5-fluoro-2-(oxan-4-ylsulfanylmethyl)-4-oxo-3H-quinazolin-7-yl]oxymethyl]piperidin-1-yl]ethyl]piperazin-1-yl]anilino]piperidine-2,6-dione.
| Compound Name | (3S)-3-[4-[4-[2-[4-[[5-fluoro-2-(oxan-4-ylsulfanylmethyl)-4-oxo-3H-quinazolin-7-yl]oxymethyl]piperidin-1-yl]ethyl]piperazin-1-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170748898 |
| Molecular Formula | C37H48FN7O5S |
| Molecular Weight | 721.90 g/mol |
| Exact Mass | 721.34 |
| IUPAC Name | (3S)-3-[4-[4-[2-[4-[[5-fluoro-2-(oxan-4-ylsulfanylmethyl)-4-oxo-3H-quinazolin-7-yl]oxymethyl]piperidin-1-yl]ethyl]piperazin-1-yl]anilino]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](Nc2ccc(N3CCN(CCN4CCC(COc5cc(F)c6c(=O)[nH]c(CSC7CCOCC7)nc6c5)CC4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C37H48FN7O5S/c38-30-21-28(22-32-35(30)37(48)41-33(40-32)24-51-29-9-19-49-20-10-29)50-23-25-7-11-43(12-8-25)13-14-44-15-17-45(18-16-44)27-3-1-26(2-4-27)39-31-5-6-34(46)42-36(31)47/h1-4,21-22,25,29,31,39H,5-20,23-24H2,(H,40,41,48)(H,42,46,47)/t31-/m0/s1 |
| InChIKey | MAGJLOXUMMNTMN-HKBQPEDESA-N |
| XLogP | 3.60 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.90 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|