C37H47F2N7O6 — CID 170749242
3-[3-fluoro-4-[4-[2-[4-[[5-fluoro-2-(oxan-4-yloxymethyl)-4-oxo-3H-quinazolin-7-yl]oxymethyl]piperidin-1-yl]ethyl]piperazin-1-yl]anilino]piperidine-2,6-dione (PubChem CID 170749242) has the molecular formula C37H47F2N7O6 and a molecular weight of 723.82 g/mol. Its IUPAC name is 3-[3-fluoro-4-[4-[2-[4-[[5-fluoro-2-(oxan-4-yloxymethyl)-4-oxo-3H-quinazolin-7-yl]oxymethyl]piperidin-1-yl]ethyl]piperazin-1-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[3-fluoro-4-[4-[2-[4-[[5-fluoro-2-(oxan-4-yloxymethyl)-4-oxo-3H-quinazolin-7-yl]oxymethyl]piperidin-1-yl]ethyl]piperazin-1-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170749242 |
| Molecular Formula | C37H47F2N7O6 |
| Molecular Weight | 723.82 g/mol |
| Exact Mass | 723.36 |
| IUPAC Name | 3-[3-fluoro-4-[4-[2-[4-[[5-fluoro-2-(oxan-4-yloxymethyl)-4-oxo-3H-quinazolin-7-yl]oxymethyl]piperidin-1-yl]ethyl]piperazin-1-yl]anilino]piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2ccc(N3CCN(CCN4CCC(COc5cc(F)c6c(=O)[nH]c(COC7CCOCC7)nc6c5)CC4)CC3)c(F)c2)C(=O)N1 |
| InChI | InChI=1S/C37H47F2N7O6/c38-28-19-25(40-30-2-4-34(47)43-36(30)48)1-3-32(28)46-15-13-45(14-16-46)12-11-44-9-5-24(6-10-44)22-51-27-20-29(39)35-31(21-27)41-33(42-37(35)49)23-52-26-7-17-50-18-8-26/h1,3,19-21,24,26,30,40H,2,4-18,22-23H2,(H,41,42,49)(H,43,47,48) |
| InChIKey | UCHOGZUEPRPBDE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.82 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|