C23H31ClFN3O3 — CID 170749422
7-[[1-(2-chloroethyl)piperidin-4-yl]methoxy]-5-fluoro-2-[2-(oxan-4-yl)ethyl]-3H-quinazolin-4-one (PubChem CID 170749422) has the molecular formula C23H31ClFN3O3 and a molecular weight of 451.97 g/mol. Its IUPAC name is 7-[[1-(2-chloroethyl)piperidin-4-yl]methoxy]-5-fluoro-2-[2-(oxan-4-yl)ethyl]-3H-quinazolin-4-one.
| Compound Name | 7-[[1-(2-chloroethyl)piperidin-4-yl]methoxy]-5-fluoro-2-[2-(oxan-4-yl)ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 170749422 |
| Molecular Formula | C23H31ClFN3O3 |
| Molecular Weight | 451.97 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 7-[[1-(2-chloroethyl)piperidin-4-yl]methoxy]-5-fluoro-2-[2-(oxan-4-yl)ethyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CCC2CCOCC2)nc2cc(OCC3CCN(CCCl)CC3)cc(F)c12 |
| InChI | InChI=1S/C23H31ClFN3O3/c24-7-10-28-8-3-17(4-9-28)15-31-18-13-19(25)22-20(14-18)26-21(27-23(22)29)2-1-16-5-11-30-12-6-16/h13-14,16-17H,1-12,15H2,(H,26,27,29) |
| InChIKey | IPFBTHQNYNBDHY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.97 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|