About ethane;(4E)-2-methyl-5-[(1-piperidin-4-ylpiperidin-4-yl)methoxy]hepta-2,4-dien-3-amine
ethane;(4E)-2-methyl-5-[(1-piperidin-4-ylpiperidin-4-yl)methoxy]hepta-2,4-dien-3-amine (PubChem CID 170749584) has the molecular formula C21H41N3O
and a molecular weight of 351.58 g/mol. Its IUPAC name is ethane;(4E)-2-methyl-5-[(1-piperidin-4-ylpiperidin-4-yl)methoxy]hepta-2,4-dien-3-amine.
Molecular Properties
| Compound Name | ethane;(4E)-2-methyl-5-[(1-piperidin-4-ylpiperidin-4-yl)methoxy]hepta-2,4-dien-3-amine |
| PubChem CID | 170749584 |
| Molecular Formula | C21H41N3O |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.32 |
| IUPAC Name | ethane;(4E)-2-methyl-5-[(1-piperidin-4-ylpiperidin-4-yl)methoxy]hepta-2,4-dien-3-amine |
| SMILES | CC.CC/C(=C\C(N)=C(C)C)OCC1CCN(C2CCNCC2)CC1 |
| InChI | InChI=1S/C19H35N3O.C2H6/c1-4-18(13-19(20)15(2)3)23-14-16-7-11-22(12-8-16)17-5-9-21-10-6-17;1-2/h13,16-17,21H,4-12,14,20H2,1-3H3;1-2H3/b18-13+; |
| InChIKey | WLFRQGVZDRZEII-PUBYZPQMSA-N |
| XLogP | 4.04 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(4E)-2-methyl-5-[(1-piperidin-4-ylpiperidin-4-yl)methoxy]hepta-2,4-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4E)-2-methyl-5-[(1-piperidin-4-ylpiperidin-4-yl)methoxy]hepta-2,4-dien-3-amine?
The IUPAC name of ethane;(4E)-2-methyl-5-[(1-piperidin-4-ylpiperidin-4-yl)methoxy]hepta-2,4-dien-3-amine (CID 170749584) is ethane;(4E)-2-methyl-5-[(1-piperidin-4-ylpiperidin-4-yl)methoxy]hepta-2,4-dien-3-amine.
What is the SMILES notation for ethane;(4E)-2-methyl-5-[(1-piperidin-4-ylpiperidin-4-yl)methoxy]hepta-2,4-dien-3-amine?
The canonical SMILES for ethane;(4E)-2-methyl-5-[(1-piperidin-4-ylpiperidin-4-yl)methoxy]hepta-2,4-dien-3-amine is CC.CC/C(=C\C(N)=C(C)C)OCC1CCN(C2CCNCC2)CC1.
What is the InChIKey of ethane;(4E)-2-methyl-5-[(1-piperidin-4-ylpiperidin-4-yl)methoxy]hepta-2,4-dien-3-amine?
The InChIKey is WLFRQGVZDRZEII-PUBYZPQMSA-N. The full InChI is InChI=1S/C19H35N3O.C2H6/c1-4-18(13-19(20)15(2)3)23-14-16-7-11-22(12-8-16)17-5-9-21-10-6-17;1-2/h13,16-17,21H,4-12,14,20H2,1-3H3;1-2H3/b18-13+;.
What are the key properties of ethane;(4E)-2-methyl-5-[(1-piperidin-4-ylpiperidin-4-yl)methoxy]hepta-2,4-dien-3-amine?
ethane;(4E)-2-methyl-5-[(1-piperidin-4-ylpiperidin-4-yl)methoxy]hepta-2,4-dien-3-amine has a molecular weight of 351.58 g/mol, XLogP of 4.04, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4E)-2-methyl-5-[(1-piperidin-4-ylpiperidin-4-yl)methoxy]hepta-2,4-dien-3-amine is sourced from PubChem (CID 170749584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).