C17H34N2O — CID 143376027
ethane;N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-1-ethylpiperidin-4-amine (PubChem CID 143376027) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is ethane;N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-1-ethylpiperidin-4-amine.
| Compound Name | ethane;N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-1-ethylpiperidin-4-amine |
|---|---|
| PubChem CID | 143376027 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | ethane;N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-1-ethylpiperidin-4-amine |
| SMILES | C=C(/C=C(\C)OCC)CNC1CCN(CC)CC1.CC |
| InChI | InChI=1S/C15H28N2O.C2H6/c1-5-17-9-7-15(8-10-17)16-12-13(3)11-14(4)18-6-2;1-2/h11,15-16H,3,5-10,12H2,1-2,4H3;1-2H3/b14-11+; |
| InChIKey | LPSNPMDNVSDZOD-JHGYPSGKSA-N |
| XLogP | 3.58 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|