C23H50N2O — CID 143375871
ethane;ethene;N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-N,1-dimethylpiperidin-4-amine (PubChem CID 143375871) has the molecular formula C23H50N2O and a molecular weight of 370.67 g/mol. Its IUPAC name is ethane;ethene;N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-N,1-dimethylpiperidin-4-amine.
| Compound Name | ethane;ethene;N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-N,1-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 143375871 |
| Molecular Formula | C23H50N2O |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 370.39 |
| IUPAC Name | ethane;ethene;N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-N,1-dimethylpiperidin-4-amine |
| SMILES | C=C.C=C(/C=C(\C)OCC)CN(C)C1CCN(C)CC1.CC.CC.CC |
| InChI | InChI=1S/C15H28N2O.3C2H6.C2H4/c1-6-18-14(3)11-13(2)12-17(5)15-7-9-16(4)10-8-15;4*1-2/h11,15H,2,6-10,12H2,1,3-5H3;3*1-2H3;1-2H2/b14-11+;;;; |
| InChIKey | JZCBKAZVJUVSCU-KJERPTQJSA-N |
| XLogP | 6.39 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|