C22H38N2O — CID 143379942
(2S,3E,4E)-2-ethyl-1-methyl-4-[1-(3-piperidin-1-ylpropoxy)propylidene]-3-prop-2-enylidenepiperidine (PubChem CID 143379942) has the molecular formula C22H38N2O and a molecular weight of 346.56 g/mol. Its IUPAC name is (2S,3E,4E)-2-ethyl-1-methyl-4-[1-(3-piperidin-1-ylpropoxy)propylidene]-3-prop-2-enylidenepiperidine.
| Compound Name | (2S,3E,4E)-2-ethyl-1-methyl-4-[1-(3-piperidin-1-ylpropoxy)propylidene]-3-prop-2-enylidenepiperidine |
|---|---|
| PubChem CID | 143379942 |
| Molecular Formula | C22H38N2O |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.30 |
| IUPAC Name | (2S,3E,4E)-2-ethyl-1-methyl-4-[1-(3-piperidin-1-ylpropoxy)propylidene]-3-prop-2-enylidenepiperidine |
| SMILES | C=C/C=C1C(=C(/CC)OCCCN2CCCCC2)\CCN(C)[C@H]\1CC |
| InChI | InChI=1S/C22H38N2O/c1-5-12-19-20(13-17-23(4)21(19)6-2)22(7-3)25-18-11-16-24-14-9-8-10-15-24/h5,12,21H,1,6-11,13-18H2,2-4H3/b19-12+,22-20+/t21-/m0/s1 |
| InChIKey | HNHALBKLAYGXGJ-SSPROWBNSA-N |
| XLogP | 4.77 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|