C20H40N2O — CID 143375785
ethane;ethene;N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-1-ethyl-N-methylpiperidin-4-amine (PubChem CID 143375785) has the molecular formula C20H40N2O and a molecular weight of 324.55 g/mol. Its IUPAC name is ethane;ethene;N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-1-ethyl-N-methylpiperidin-4-amine.
| Compound Name | ethane;ethene;N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-1-ethyl-N-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 143375785 |
| Molecular Formula | C20H40N2O |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.31 |
| IUPAC Name | ethane;ethene;N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-1-ethyl-N-methylpiperidin-4-amine |
| SMILES | C=C.C=C(/C=C(\C)OCC)CN(C)C1CCN(CC)CC1.CC |
| InChI | InChI=1S/C16H30N2O.C2H6.C2H4/c1-6-18-10-8-16(9-11-18)17(5)13-14(3)12-15(4)19-7-2;2*1-2/h12,16H,3,6-11,13H2,1-2,4-5H3;1-2H3;1-2H2/b15-12+;; |
| InChIKey | LMENPMYJJSUQCL-BXHFOUFMSA-N |
| XLogP | 4.73 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|