C26H49N3O — CID 143623191
but-1-ene;1-[(2E,4E)-2-[(E)-but-2-en-2-yl]-5-[3-(dimethylamino)propoxy]hexa-2,4-dienyl]-N,N-dimethylpiperidin-3-amine (PubChem CID 143623191) has the molecular formula C26H49N3O and a molecular weight of 419.70 g/mol. Its IUPAC name is but-1-ene;1-[(2E,4E)-2-[(E)-but-2-en-2-yl]-5-[3-(dimethylamino)propoxy]hexa-2,4-dienyl]-N,N-dimethylpiperidin-3-amine.
| Compound Name | but-1-ene;1-[(2E,4E)-2-[(E)-but-2-en-2-yl]-5-[3-(dimethylamino)propoxy]hexa-2,4-dienyl]-N,N-dimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 143623191 |
| Molecular Formula | C26H49N3O |
| Molecular Weight | 419.70 g/mol |
| Exact Mass | 419.39 |
| IUPAC Name | but-1-ene;1-[(2E,4E)-2-[(E)-but-2-en-2-yl]-5-[3-(dimethylamino)propoxy]hexa-2,4-dienyl]-N,N-dimethylpiperidin-3-amine |
| SMILES | C/C=C(C)/C(=C\C=C(/C)OCCCN(C)C)CN1CCCC(N(C)C)C1.C=CCC |
| InChI | InChI=1S/C22H41N3O.C4H8/c1-8-19(2)21(13-12-20(3)26-16-10-14-23(4)5)17-25-15-9-11-22(18-25)24(6)7;1-3-4-2/h8,12-13,22H,9-11,14-18H2,1-7H3;3H,1,4H2,2H3/b19-8+,20-12+,21-13-; |
| InChIKey | DNAIBHLVLZPIGO-HDMFZTNKSA-N |
| XLogP | 5.36 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.70 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|