C15H30N2O — CID 143375654
3-N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-1-N-ethyl-1-N-methylbutane-1,3-diamine (PubChem CID 143375654) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 3-N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-1-N-ethyl-1-N-methylbutane-1,3-diamine.
| Compound Name | 3-N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-1-N-ethyl-1-N-methylbutane-1,3-diamine |
|---|---|
| PubChem CID | 143375654 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 3-N-[(E)-4-ethoxy-2-methylidenepent-3-enyl]-1-N-ethyl-1-N-methylbutane-1,3-diamine |
| SMILES | C=C(/C=C(\C)OCC)CNC(C)CCN(C)CC |
| InChI | InChI=1S/C15H30N2O/c1-7-17(6)10-9-14(4)16-12-13(3)11-15(5)18-8-2/h11,14,16H,3,7-10,12H2,1-2,4-6H3/b15-11+ |
| InChIKey | YXYURNVLTHTXMB-RVDMUPIBSA-N |
| XLogP | 2.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|