C19H37N3O — CID 143378321
methanamine;N-[(2E)-5-methyl-2-prop-1-en-2-ylhexa-2,4-dienyl]-N'-(oxan-4-yl)propane-1,3-diamine (PubChem CID 143378321) has the molecular formula C19H37N3O and a molecular weight of 323.53 g/mol. Its IUPAC name is methanamine;N-[(2E)-5-methyl-2-prop-1-en-2-ylhexa-2,4-dienyl]-N'-(oxan-4-yl)propane-1,3-diamine.
| Compound Name | methanamine;N-[(2E)-5-methyl-2-prop-1-en-2-ylhexa-2,4-dienyl]-N'-(oxan-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 143378321 |
| Molecular Formula | C19H37N3O |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.29 |
| IUPAC Name | methanamine;N-[(2E)-5-methyl-2-prop-1-en-2-ylhexa-2,4-dienyl]-N'-(oxan-4-yl)propane-1,3-diamine |
| SMILES | C=C(C)/C(=C\C=C(C)C)CNCCCNC1CCOCC1.CN |
| InChI | InChI=1S/C18H32N2O.CH5N/c1-15(2)6-7-17(16(3)4)14-19-10-5-11-20-18-8-12-21-13-9-18;1-2/h6-7,18-20H,3,5,8-14H2,1-2,4H3;2H2,1H3/b17-7-; |
| InChIKey | UFBJOXWTXTXVDI-TULZRXOXSA-N |
| XLogP | 2.78 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|