C18H32N2O — CID 143378322
N-[(2E)-5-methyl-2-prop-1-en-2-ylhexa-2,4-dienyl]-N'-(oxan-4-yl)propane-1,3-diamine (PubChem CID 143378322) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is N-[(2E)-5-methyl-2-prop-1-en-2-ylhexa-2,4-dienyl]-N'-(oxan-4-yl)propane-1,3-diamine.
| Compound Name | N-[(2E)-5-methyl-2-prop-1-en-2-ylhexa-2,4-dienyl]-N'-(oxan-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 143378322 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | N-[(2E)-5-methyl-2-prop-1-en-2-ylhexa-2,4-dienyl]-N'-(oxan-4-yl)propane-1,3-diamine |
| SMILES | C=C(C)/C(=C\C=C(C)C)CNCCCNC1CCOCC1 |
| InChI | InChI=1S/C18H32N2O/c1-15(2)6-7-17(16(3)4)14-19-10-5-11-20-18-8-12-21-13-9-18/h6-7,18-20H,3,5,8-14H2,1-2,4H3/b17-7- |
| InChIKey | WBXOFGDKLJYYTQ-IDUWFGFVSA-N |
| XLogP | 3.20 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|