C18H32N2O — CID 142906944
N-[(3Z,5Z)-2-methylhepta-3,5-dienyl]-N-(oxan-4-yl)piperidin-4-amine (PubChem CID 142906944) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is N-[(3Z,5Z)-2-methylhepta-3,5-dienyl]-N-(oxan-4-yl)piperidin-4-amine.
| Compound Name | N-[(3Z,5Z)-2-methylhepta-3,5-dienyl]-N-(oxan-4-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 142906944 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | N-[(3Z,5Z)-2-methylhepta-3,5-dienyl]-N-(oxan-4-yl)piperidin-4-amine |
| SMILES | C/C=C\C=C/C(C)CN(C1CCNCC1)C1CCOCC1 |
| InChI | InChI=1S/C18H32N2O/c1-3-4-5-6-16(2)15-20(17-7-11-19-12-8-17)18-9-13-21-14-10-18/h3-6,16-19H,7-15H2,1-2H3/b4-3-,6-5- |
| InChIKey | NIQWJRLLRHFRLK-OUPQRBNQSA-N |
| XLogP | 2.99 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|